C16H19ClN4O3 — CID 171802265
prop-2-enyl N-[4-[(4-amino-1-methylpyrrole-2-carbonyl)amino]phenyl]carbamate;hydrochloride (PubChem CID 171802265) has the molecular formula C16H19ClN4O3 and a molecular weight of 350.81 g/mol. Its IUPAC name is prop-2-enyl N-[4-[(4-amino-1-methylpyrrole-2-carbonyl)amino]phenyl]carbamate;hydrochloride.
| Compound Name | prop-2-enyl N-[4-[(4-amino-1-methylpyrrole-2-carbonyl)amino]phenyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 171802265 |
| Molecular Formula | C16H19ClN4O3 |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | prop-2-enyl N-[4-[(4-amino-1-methylpyrrole-2-carbonyl)amino]phenyl]carbamate;hydrochloride |
| SMILES | C=CCOC(=O)Nc1ccc(NC(=O)c2cc(N)cn2C)cc1.Cl |
| InChI | InChI=1S/C16H18N4O3.ClH/c1-3-8-23-16(22)19-13-6-4-12(5-7-13)18-15(21)14-9-11(17)10-20(14)2;/h3-7,9-10H,1,8,17H2,2H3,(H,18,21)(H,19,22);1H |
| InChIKey | GORICGGJHDCNHT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|