C14H17N3O2 — CID 61236398
4-amino-N-[4-(2-hydroxyethyl)phenyl]-1-methylpyrrole-2-carboxamide (PubChem CID 61236398) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-amino-N-[4-(2-hydroxyethyl)phenyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-amino-N-[4-(2-hydroxyethyl)phenyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 61236398 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 4-amino-N-[4-(2-hydroxyethyl)phenyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(N)cc1C(=O)Nc1ccc(CCO)cc1 |
| InChI | InChI=1S/C14H17N3O2/c1-17-9-11(15)8-13(17)14(19)16-12-4-2-10(3-5-12)6-7-18/h2-5,8-9,18H,6-7,15H2,1H3,(H,16,19) |
| InChIKey | RQOVDCPTFPSMLK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |