C24H25F3N2O3 — CID 171802931
tert-butyl 3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-4-hydroxyimino-2-azabicyclo[3.1.1]heptane-2-carboxylate (PubChem CID 171802931) has the molecular formula C24H25F3N2O3 and a molecular weight of 446.47 g/mol. Its IUPAC name is tert-butyl 3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-4-hydroxyimino-2-azabicyclo[3.1.1]heptane-2-carboxylate.
| Compound Name | tert-butyl 3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-4-hydroxyimino-2-azabicyclo[3.1.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 171802931 |
| Molecular Formula | C24H25F3N2O3 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | tert-butyl 3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-4-hydroxyimino-2-azabicyclo[3.1.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CC(C2)C(=NO)C1Cc1cccc(-c2cc(F)cc(F)c2)c1F |
| InChI | InChI=1S/C24H25F3N2O3/c1-24(2,3)32-23(30)29-18-9-15(10-18)22(28-31)20(29)11-13-5-4-6-19(21(13)27)14-7-16(25)12-17(26)8-14/h4-8,12,15,18,20,31H,9-11H2,1-3H3 |
| InChIKey | NFKYGWVZJGJXOB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|