C14H19BrFNOS — CID 171803415
N-[2-(4-bromo-2-fluorophenyl)cyclobutyl]-2-methylpropane-2-sulfinamide (PubChem CID 171803415) has the molecular formula C14H19BrFNOS and a molecular weight of 348.28 g/mol. Its IUPAC name is N-[2-(4-bromo-2-fluorophenyl)cyclobutyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[2-(4-bromo-2-fluorophenyl)cyclobutyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 171803415 |
| Molecular Formula | C14H19BrFNOS |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | N-[2-(4-bromo-2-fluorophenyl)cyclobutyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)NC1CCC1c1ccc(Br)cc1F |
| InChI | InChI=1S/C14H19BrFNOS/c1-14(2,3)19(18)17-13-7-6-11(13)10-5-4-9(15)8-12(10)16/h4-5,8,11,13,17H,6-7H2,1-3H3 |
| InChIKey | RAVFYUBDXVREFV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |