C9H22N4O2 — CID 171804657
N-[4-(aminooxyamino)butyl]-2-(propan-2-ylamino)acetamide (PubChem CID 171804657) has the molecular formula C9H22N4O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is N-[4-(aminooxyamino)butyl]-2-(propan-2-ylamino)acetamide.
| Compound Name | N-[4-(aminooxyamino)butyl]-2-(propan-2-ylamino)acetamide |
|---|---|
| PubChem CID | 171804657 |
| Molecular Formula | C9H22N4O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | N-[4-(aminooxyamino)butyl]-2-(propan-2-ylamino)acetamide |
| SMILES | CC(C)NCC(=O)NCCCCNON |
| InChI | InChI=1S/C9H22N4O2/c1-8(2)12-7-9(14)11-5-3-4-6-13-15-10/h8,12-13H,3-7,10H2,1-2H3,(H,11,14) |
| InChIKey | NLSMPZNBFHKOHQ-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|