C26H40N6O8 — CID 171804796
5-[[1-[[2-[4-(acetyloxymethyl)-3-(2-aminoethylcarbamoyl)anilino]-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-(ethylamino)-5-oxopentanoic acid (PubChem CID 171804796) has the molecular formula C26H40N6O8 and a molecular weight of 564.64 g/mol. Its IUPAC name is 5-[[1-[[2-[4-(acetyloxymethyl)-3-(2-aminoethylcarbamoyl)anilino]-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-(ethylamino)-5-oxopentanoic acid.
| Compound Name | 5-[[1-[[2-[4-(acetyloxymethyl)-3-(2-aminoethylcarbamoyl)anilino]-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-(ethylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 171804796 |
| Molecular Formula | C26H40N6O8 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | 5-[[1-[[2-[4-(acetyloxymethyl)-3-(2-aminoethylcarbamoyl)anilino]-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-(ethylamino)-5-oxopentanoic acid |
| SMILES | CCNC(CCC(=O)O)C(=O)NC(C(=O)NCC(=O)Nc1ccc(COC(C)=O)c(C(=O)NCCN)c1)C(C)C |
| InChI | InChI=1S/C26H40N6O8/c1-5-28-20(8-9-22(35)36)25(38)32-23(15(2)3)26(39)30-13-21(34)31-18-7-6-17(14-40-16(4)33)19(12-18)24(37)29-11-10-27/h6-7,12,15,20,23,28H,5,8-11,13-14,27H2,1-4H3,(H,29,37)(H,30,39)(H,31,34)(H,32,38)(H,35,36) |
| InChIKey | OJZUHGPHFWFJME-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 218.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |