C38H65N9O11 — CID 171804643
[2-(2-aminoethylcarbamoyl)-4-[[2-[[3-methyl-2-[[2-[3-(4-methyl-3-oxopentoxy)propanoylamino]acetyl]amino]butanoyl]amino]acetyl]amino]phenyl]methyl propanoate;propanamide;propylurea (PubChem CID 171804643) has the molecular formula C38H65N9O11 and a molecular weight of 823.99 g/mol. Its IUPAC name is [2-(2-aminoethylcarbamoyl)-4-[[2-[[3-methyl-2-[[2-[3-(4-methyl-3-oxopentoxy)propanoylamino]acetyl]amino]butanoyl]amino]acetyl]amino]phenyl]methyl propanoate;propanamide;propylurea.
| Compound Name | [2-(2-aminoethylcarbamoyl)-4-[[2-[[3-methyl-2-[[2-[3-(4-methyl-3-oxopentoxy)propanoylamino]acetyl]amino]butanoyl]amino]acetyl]amino]phenyl]methyl propanoate;propanamide;propylurea |
|---|---|
| PubChem CID | 171804643 |
| Molecular Formula | C38H65N9O11 |
| Molecular Weight | 823.99 g/mol |
| Exact Mass | 823.48 |
| IUPAC Name | [2-(2-aminoethylcarbamoyl)-4-[[2-[[3-methyl-2-[[2-[3-(4-methyl-3-oxopentoxy)propanoylamino]acetyl]amino]butanoyl]amino]acetyl]amino]phenyl]methyl propanoate;propanamide;propylurea |
| SMILES | CCC(=O)OCc1ccc(NC(=O)CNC(=O)C(NC(=O)CNC(=O)CCOCCC(=O)C(C)C)C(C)C)cc1C(=O)NCCN.CCC(N)=O.CCCNC(N)=O |
| InChI | InChI=1S/C31H48N6O9.C4H10N2O.C3H7NO/c1-6-28(42)46-18-21-7-8-22(15-23(21)30(43)33-12-11-32)36-26(40)17-35-31(44)29(20(4)5)37-27(41)16-34-25(39)10-14-45-13-9-24(38)19(2)3;1-2-3-6-4(5)7;1-2-3(4)5/h7-8,15,19-20,29H,6,9-14,16-18,32H2,1-5H3,(H,33,43)(H,34,39)(H,35,44)(H,36,40)(H,37,41);2-3H2,1H3,(H3,5,6,7);2H2,1H3,(H2,4,5) |
| InChIKey | WPTHHVXPDWSWOG-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 322.33 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.99 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|