C17H17ClN4O2 — CID 171806632
8-(4-chlorophenyl)-7-propan-2-yl-2-prop-2-enoxy-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one (PubChem CID 171806632) has the molecular formula C17H17ClN4O2 and a molecular weight of 344.80 g/mol. Its IUPAC name is 8-(4-chlorophenyl)-7-propan-2-yl-2-prop-2-enoxy-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one.
| Compound Name | 8-(4-chlorophenyl)-7-propan-2-yl-2-prop-2-enoxy-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 171806632 |
| Molecular Formula | C17H17ClN4O2 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 8-(4-chlorophenyl)-7-propan-2-yl-2-prop-2-enoxy-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one |
| SMILES | C=CCOc1nc2c(-c3ccc(Cl)cc3)c(C(C)C)nn2c(=O)[nH]1 |
| InChI | InChI=1S/C17H17ClN4O2/c1-4-9-24-16-19-15-13(11-5-7-12(18)8-6-11)14(10(2)3)21-22(15)17(23)20-16/h4-8,10H,1,9H2,2-3H3,(H,19,20,23) |
| InChIKey | PNUGQDCPIXOVPV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|