C17H27N3O3 — CID 171807719
tert-butyl 3-[2-(6-amino-5-methoxy-2-pyridinyl)ethyl]pyrrolidine-1-carboxylate (PubChem CID 171807719) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is tert-butyl 3-[2-(6-amino-5-methoxy-2-pyridinyl)ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(6-amino-5-methoxy-2-pyridinyl)ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 171807719 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | tert-butyl 3-[2-(6-amino-5-methoxy-2-pyridinyl)ethyl]pyrrolidine-1-carboxylate |
| SMILES | COc1ccc(CCC2CCN(C(=O)OC(C)(C)C)C2)nc1N |
| InChI | InChI=1S/C17H27N3O3/c1-17(2,3)23-16(21)20-10-9-12(11-20)5-6-13-7-8-14(22-4)15(18)19-13/h7-8,12H,5-6,9-11H2,1-4H3,(H2,18,19) |
| InChIKey | OWZCDCVPHHRSBR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |