C11H13LiN2O3 — CID 171808777
lithium 2-[1-(2-methoxy-4-pyridinyl)azetidin-3-yl]acetate (PubChem CID 171808777) has the molecular formula C11H13LiN2O3 and a molecular weight of 228.18 g/mol. Its IUPAC name is lithium 2-[1-(2-methoxy-4-pyridinyl)azetidin-3-yl]acetate.
| Compound Name | lithium 2-[1-(2-methoxy-4-pyridinyl)azetidin-3-yl]acetate |
|---|---|
| PubChem CID | 171808777 |
| Molecular Formula | C11H13LiN2O3 |
| Molecular Weight | 228.18 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | lithium 2-[1-(2-methoxy-4-pyridinyl)azetidin-3-yl]acetate |
| SMILES | COc1cc(N2CC(CC(=O)[O-])C2)ccn1.[Li+] |
| InChI | InChI=1S/C11H14N2O3.Li/c1-16-10-5-9(2-3-12-10)13-6-8(7-13)4-11(14)15;/h2-3,5,8H,4,6-7H2,1H3,(H,14,15);/q;+1/p-1 |
| InChIKey | YPPIZFWLNHYETB-UHFFFAOYSA-M |
| XLogP | -3.33 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.18 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |