C17H16N4O4 — CID 171809218
3-[7-[3-(aminomethyl)-1,2-oxazol-5-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171809218) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is 3-[7-[3-(aminomethyl)-1,2-oxazol-5-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[3-(aminomethyl)-1,2-oxazol-5-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171809218 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 3-[7-[3-(aminomethyl)-1,2-oxazol-5-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | NCc1cc(-c2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)on1 |
| InChI | InChI=1S/C17H16N4O4/c18-7-9-6-14(25-20-9)10-2-1-3-11-12(10)8-21(17(11)24)13-4-5-15(22)19-16(13)23/h1-3,6,13H,4-5,7-8,18H2,(H,19,22,23) |
| InChIKey | GCSZOOHOXNPRPW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|