C11H19N3O2 — CID 171811138
(2Z,4Z)-2,5-diamino-1-(3-hydroxy-3-methylpyrrolidin-1-yl)-4-methylpenta-2,4-dien-1-one (PubChem CID 171811138) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is (2Z,4Z)-2,5-diamino-1-(3-hydroxy-3-methylpyrrolidin-1-yl)-4-methylpenta-2,4-dien-1-one.
| Compound Name | (2Z,4Z)-2,5-diamino-1-(3-hydroxy-3-methylpyrrolidin-1-yl)-4-methylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 171811138 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | (2Z,4Z)-2,5-diamino-1-(3-hydroxy-3-methylpyrrolidin-1-yl)-4-methylpenta-2,4-dien-1-one |
| SMILES | CC(=C/N)/C=C(\N)C(=O)N1CCC(C)(O)C1 |
| InChI | InChI=1S/C11H19N3O2/c1-8(6-12)5-9(13)10(15)14-4-3-11(2,16)7-14/h5-6,16H,3-4,7,12-13H2,1-2H3/b8-6-,9-5- |
| InChIKey | LLJIJRDZMQTHBP-VZPCVYTNSA-N |
| XLogP | -0.33 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|