C15H23N3O2 — CID 171811445
(2Z,4Z)-2-amino-1-[4-(cyclopropanecarbonyl)piperazin-1-yl]-4-methylhexa-2,4-dien-1-one (PubChem CID 171811445) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is (2Z,4Z)-2-amino-1-[4-(cyclopropanecarbonyl)piperazin-1-yl]-4-methylhexa-2,4-dien-1-one.
| Compound Name | (2Z,4Z)-2-amino-1-[4-(cyclopropanecarbonyl)piperazin-1-yl]-4-methylhexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 171811445 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (2Z,4Z)-2-amino-1-[4-(cyclopropanecarbonyl)piperazin-1-yl]-4-methylhexa-2,4-dien-1-one |
| SMILES | C/C=C(C)\C=C(/N)C(=O)N1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C15H23N3O2/c1-3-11(2)10-13(16)15(20)18-8-6-17(7-9-18)14(19)12-4-5-12/h3,10,12H,4-9,16H2,1-2H3/b11-3-,13-10- |
| InChIKey | OELYSAQYVMCSHD-WCBZKNPZSA-N |
| XLogP | 0.88 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|