C27H48O3S — CID 171817102
6-(10,13-dimethyl-3-sulfanyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhexan-2-ol;methanol (PubChem CID 171817102) has the molecular formula C27H48O3S and a molecular weight of 452.75 g/mol. Its IUPAC name is 6-(10,13-dimethyl-3-sulfanyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhexan-2-ol;methanol.
| Compound Name | 6-(10,13-dimethyl-3-sulfanyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhexan-2-ol;methanol |
|---|---|
| PubChem CID | 171817102 |
| Molecular Formula | C27H48O3S |
| Molecular Weight | 452.75 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | 6-(10,13-dimethyl-3-sulfanyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhexan-2-ol;methanol |
| SMILES | CC(C)(O)CCCCC1CCC2C3CC=C4CC(OS)CCC4(C)C3CCC12C.CO |
| InChI | InChI=1S/C26H44O2S.CH4O/c1-24(2,27)14-6-5-7-18-9-11-22-21-10-8-19-17-20(28-29)12-15-26(19,4)23(21)13-16-25(18,22)3;1-2/h8,18,20-23,27,29H,5-7,9-17H2,1-4H3;2H,1H3 |
| InChIKey | SOLRQOBHBNOCMS-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.75 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|