C14H15ClN2OS2 — CID 17181717
1-[1-(5-chlorothiophen-2-yl)ethyl]-3-(3-methylsulfanylphenyl)urea (PubChem CID 17181717) has the molecular formula C14H15ClN2OS2 and a molecular weight of 326.87 g/mol. Its IUPAC name is 1-[1-(5-chlorothiophen-2-yl)ethyl]-3-(3-methylsulfanylphenyl)urea.
| Compound Name | 1-[1-(5-chlorothiophen-2-yl)ethyl]-3-(3-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 17181717 |
| Molecular Formula | C14H15ClN2OS2 |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 1-[1-(5-chlorothiophen-2-yl)ethyl]-3-(3-methylsulfanylphenyl)urea |
| SMILES | CSc1cccc(NC(=O)NC(C)c2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C14H15ClN2OS2/c1-9(12-6-7-13(15)20-12)16-14(18)17-10-4-3-5-11(8-10)19-2/h3-9H,1-2H3,(H2,16,17,18) |
| InChIKey | YILXRAOTKNDKGG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |