C17H29FN2O — CID 171817523
ethane;2-fluoro-N-[(5-methylpyrrolidin-3-yl)methyl]benzamide (PubChem CID 171817523) has the molecular formula C17H29FN2O and a molecular weight of 296.43 g/mol. Its IUPAC name is ethane;2-fluoro-N-[(5-methylpyrrolidin-3-yl)methyl]benzamide.
| Compound Name | ethane;2-fluoro-N-[(5-methylpyrrolidin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 171817523 |
| Molecular Formula | C17H29FN2O |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | ethane;2-fluoro-N-[(5-methylpyrrolidin-3-yl)methyl]benzamide |
| SMILES | CC.CC.CC1CC(CNC(=O)c2ccccc2F)CN1 |
| InChI | InChI=1S/C13H17FN2O.2C2H6/c1-9-6-10(7-15-9)8-16-13(17)11-4-2-3-5-12(11)14;2*1-2/h2-5,9-10,15H,6-8H2,1H3,(H,16,17);2*1-2H3 |
| InChIKey | LIWUGMPXSYUPHM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |