C23H29F2N5O5S — CID 171819190
N-[5-[(E)-[(Z)-4-aminobut-3-en-2-ylidene]amino]-1,3,4-thiadiazol-2-yl]-4-[3-[(1S,2R)-2-(2,2-difluoroethoxy)-2-methylcyclobutyl]propyl]-5-methoxy-6-oxopyran-2-carboxamide (PubChem CID 171819190) has the molecular formula C23H29F2N5O5S and a molecular weight of 525.58 g/mol. Its IUPAC name is N-[5-[(E)-[(Z)-4-aminobut-3-en-2-ylidene]amino]-1,3,4-thiadiazol-2-yl]-4-[3-[(1S,2R)-2-(2,2-difluoroethoxy)-2-methylcyclobutyl]propyl]-5-methoxy-6-oxopyran-2-carboxamide.
| Compound Name | N-[5-[(E)-[(Z)-4-aminobut-3-en-2-ylidene]amino]-1,3,4-thiadiazol-2-yl]-4-[3-[(1S,2R)-2-(2,2-difluoroethoxy)-2-methylcyclobutyl]propyl]-5-methoxy-6-oxopyran-2-carboxamide |
|---|---|
| PubChem CID | 171819190 |
| Molecular Formula | C23H29F2N5O5S |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | N-[5-[(E)-[(Z)-4-aminobut-3-en-2-ylidene]amino]-1,3,4-thiadiazol-2-yl]-4-[3-[(1S,2R)-2-(2,2-difluoroethoxy)-2-methylcyclobutyl]propyl]-5-methoxy-6-oxopyran-2-carboxamide |
| SMILES | COc1c(CCC[C@H]2CC[C@@]2(C)OCC(F)F)cc(C(=O)Nc2nnc(/N=C(C)/C=C\N)s2)oc1=O |
| InChI | InChI=1S/C23H29F2N5O5S/c1-13(8-10-26)27-21-29-30-22(36-21)28-19(31)16-11-14(18(33-3)20(32)35-16)5-4-6-15-7-9-23(15,2)34-12-17(24)25/h8,10-11,15,17H,4-7,9,12,26H2,1-3H3,(H,28,30,31)/b10-8-,27-13+/t15-,23+/m0/s1 |
| InChIKey | PHFJVPMJDXZZES-LMDCRELPSA-N |
| XLogP | 4.09 |
| TPSA | 141.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|