C20H25N6O5SSi — CID 174343817
CID 174343817 (PubChem CID 174343817) has the molecular formula C20H25N6O5SSi and a molecular weight of 489.61 g/mol.
| Compound Name | CID 174343817 |
|---|---|
| PubChem CID | 174343817 |
| Molecular Formula | C20H25N6O5SSi |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | — |
| SMILES | COc1c(N[C@@H]([Si])[C@H]2CCC[C@H]2OC)cc(C(=O)Nc2nnc(N=C(C)C=CN)s2)oc1=O |
| InChI | InChI=1S/C20H25N6O5SSi/c1-10(7-8-21)22-19-25-26-20(32-19)24-16(27)14-9-12(15(30-3)18(28)31-14)23-17(33)11-5-4-6-13(11)29-2/h7-9,11,13,17,23H,4-6,21H2,1-3H3,(H,24,26,27)/t11-,13+,17-/m0/s1 |
| InChIKey | QOQFTTHGIFNRGX-PPHDSNJXSA-N |
| XLogP | 2.04 |
| TPSA | 153.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|