C23H25N5O2 — CID 171819984
3-amino-4-(2,6-dimethyl-3-phenylmethoxyphenyl)-5-methanimidoyl-6-(methylamino)pyridine-2-carboxamide (PubChem CID 171819984) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 3-amino-4-(2,6-dimethyl-3-phenylmethoxyphenyl)-5-methanimidoyl-6-(methylamino)pyridine-2-carboxamide.
| Compound Name | 3-amino-4-(2,6-dimethyl-3-phenylmethoxyphenyl)-5-methanimidoyl-6-(methylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 171819984 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 3-amino-4-(2,6-dimethyl-3-phenylmethoxyphenyl)-5-methanimidoyl-6-(methylamino)pyridine-2-carboxamide |
| SMILES | [H]/N=C/c1c(NC)nc(C(N)=O)c(N)c1-c1c(C)ccc(OCc2ccccc2)c1C |
| InChI | InChI=1S/C23H25N5O2/c1-13-9-10-17(30-12-15-7-5-4-6-8-15)14(2)18(13)19-16(11-24)23(27-3)28-21(20(19)25)22(26)29/h4-11,24H,12,25H2,1-3H3,(H2,26,29)(H,27,28)/b24-11+ |
| InChIKey | FSBPRRFGUPNZOQ-BHGWPJFGSA-N |
| XLogP | 3.66 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|