About 7-amino-8-bromoimidazo[1,2-a]pyridine-6-carboxamide
7-amino-8-bromoimidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 171820259) has the molecular formula C8H7BrN4O
and a molecular weight of 255.07 g/mol. Its IUPAC name is 7-amino-8-bromoimidazo[1,2-a]pyridine-6-carboxamide.
Molecular Properties
| Compound Name | 7-amino-8-bromoimidazo[1,2-a]pyridine-6-carboxamide |
| PubChem CID | 171820259 |
| Molecular Formula | C8H7BrN4O |
| Molecular Weight | 255.07 g/mol |
| Exact Mass | 253.98 |
| IUPAC Name | 7-amino-8-bromoimidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | NC(=O)c1cn2ccnc2c(Br)c1N |
| InChI | InChI=1S/C8H7BrN4O/c9-5-6(10)4(7(11)14)3-13-2-1-12-8(5)13/h1-3H,10H2,(H2,11,14) |
| InChIKey | SNOIEPVIAFNROE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 86.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.07 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-amino-8-bromoimidazo[1,2-a]pyridine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-8-bromoimidazo[1,2-a]pyridine-6-carboxamide?
The IUPAC name of 7-amino-8-bromoimidazo[1,2-a]pyridine-6-carboxamide (CID 171820259) is 7-amino-8-bromoimidazo[1,2-a]pyridine-6-carboxamide.
What is the SMILES notation for 7-amino-8-bromoimidazo[1,2-a]pyridine-6-carboxamide?
The canonical SMILES for 7-amino-8-bromoimidazo[1,2-a]pyridine-6-carboxamide is NC(=O)c1cn2ccnc2c(Br)c1N.
What is the InChIKey of 7-amino-8-bromoimidazo[1,2-a]pyridine-6-carboxamide?
The InChIKey is SNOIEPVIAFNROE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN4O/c9-5-6(10)4(7(11)14)3-13-2-1-12-8(5)13/h1-3H,10H2,(H2,11,14).
What are the key properties of 7-amino-8-bromoimidazo[1,2-a]pyridine-6-carboxamide?
7-amino-8-bromoimidazo[1,2-a]pyridine-6-carboxamide has a molecular weight of 255.07 g/mol, XLogP of 0.78, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-8-bromoimidazo[1,2-a]pyridine-6-carboxamide is sourced from PubChem (CID 171820259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).