C22H19F4N6O8P — CID 171823578
N-acetyl-N-[[4-amino-1-(trihydroxymethyl)pyrazolo[4,5-c]quinoline-8-carbonyl]-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]amino]-hydroperoxyphosphonamidous acid (PubChem CID 171823578) has the molecular formula C22H19F4N6O8P and a molecular weight of 602.39 g/mol. Its IUPAC name is N-acetyl-N-[[4-amino-1-(trihydroxymethyl)pyrazolo[4,5-c]quinoline-8-carbonyl]-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]amino]-hydroperoxyphosphonamidous acid.
| Compound Name | N-acetyl-N-[[4-amino-1-(trihydroxymethyl)pyrazolo[4,5-c]quinoline-8-carbonyl]-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]amino]-hydroperoxyphosphonamidous acid |
|---|---|
| PubChem CID | 171823578 |
| Molecular Formula | C22H19F4N6O8P |
| Molecular Weight | 602.39 g/mol |
| Exact Mass | 602.09 |
| IUPAC Name | N-acetyl-N-[[4-amino-1-(trihydroxymethyl)pyrazolo[4,5-c]quinoline-8-carbonyl]-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]amino]-hydroperoxyphosphonamidous acid |
| SMILES | CC(=O)N(N(Cc1ccc(C(F)(F)F)cc1F)C(=O)c1ccc2nc(N)c3cnn(C(O)(O)O)c3c2c1)P(O)OO |
| InChI | InChI=1S/C22H19F4N6O8P/c1-10(33)32(41(39)40-38)30(9-12-2-4-13(7-16(12)23)21(24,25)26)20(34)11-3-5-17-14(6-11)18-15(19(27)29-17)8-28-31(18)22(35,36)37/h2-8,35-39H,9H2,1H3,(H2,27,29) |
| InChIKey | NWZCLHMGDKRSIQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 207.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|