C21H22ClFN2O3 — CID 171824820
(4-chlorophenyl)methyl N-[4-[2-(4-fluoropiperidin-1-yl)-2-oxoethyl]phenyl]carbamate (PubChem CID 171824820) has the molecular formula C21H22ClFN2O3 and a molecular weight of 404.87 g/mol. Its IUPAC name is (4-chlorophenyl)methyl N-[4-[2-(4-fluoropiperidin-1-yl)-2-oxoethyl]phenyl]carbamate.
| Compound Name | (4-chlorophenyl)methyl N-[4-[2-(4-fluoropiperidin-1-yl)-2-oxoethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 171824820 |
| Molecular Formula | C21H22ClFN2O3 |
| Molecular Weight | 404.87 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | (4-chlorophenyl)methyl N-[4-[2-(4-fluoropiperidin-1-yl)-2-oxoethyl]phenyl]carbamate |
| SMILES | O=C(Nc1ccc(CC(=O)N2CCC(F)CC2)cc1)OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClFN2O3/c22-17-5-1-16(2-6-17)14-28-21(27)24-19-7-3-15(4-8-19)13-20(26)25-11-9-18(23)10-12-25/h1-8,18H,9-14H2,(H,24,27) |
| InChIKey | CUBVUVISZFJHKC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.87 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |