C16H27N3O4SSi — CID 171825047
ethyl 2-[[4-amino-3-(4,4-dimethyl-1,4-azasilinan-1-yl)phenyl]sulfamoyl]acetate (PubChem CID 171825047) has the molecular formula C16H27N3O4SSi and a molecular weight of 385.56 g/mol. Its IUPAC name is ethyl 2-[[4-amino-3-(4,4-dimethyl-1,4-azasilinan-1-yl)phenyl]sulfamoyl]acetate.
| Compound Name | ethyl 2-[[4-amino-3-(4,4-dimethyl-1,4-azasilinan-1-yl)phenyl]sulfamoyl]acetate |
|---|---|
| PubChem CID | 171825047 |
| Molecular Formula | C16H27N3O4SSi |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | ethyl 2-[[4-amino-3-(4,4-dimethyl-1,4-azasilinan-1-yl)phenyl]sulfamoyl]acetate |
| SMILES | CCOC(=O)CS(=O)(=O)Nc1ccc(N)c(N2CC[Si](C)(C)CC2)c1 |
| InChI | InChI=1S/C16H27N3O4SSi/c1-4-23-16(20)12-24(21,22)18-13-5-6-14(17)15(11-13)19-7-9-25(2,3)10-8-19/h5-6,11,18H,4,7-10,12,17H2,1-3H3 |
| InChIKey | XGOBRTDSLAHALH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|