C16H22BrN3O3 — CID 171826976
tert-butyl 4-(2-amino-3-bromophenyl)-2-methyl-3-oxopiperazine-1-carboxylate (PubChem CID 171826976) has the molecular formula C16H22BrN3O3 and a molecular weight of 384.27 g/mol. Its IUPAC name is tert-butyl 4-(2-amino-3-bromophenyl)-2-methyl-3-oxopiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-amino-3-bromophenyl)-2-methyl-3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 171826976 |
| Molecular Formula | C16H22BrN3O3 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | tert-butyl 4-(2-amino-3-bromophenyl)-2-methyl-3-oxopiperazine-1-carboxylate |
| SMILES | CC1C(=O)N(c2cccc(Br)c2N)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22BrN3O3/c1-10-14(21)20(12-7-5-6-11(17)13(12)18)9-8-19(10)15(22)23-16(2,3)4/h5-7,10H,8-9,18H2,1-4H3 |
| InChIKey | UETXWZVBDHFTAA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|