C12H24F2N2O — CID 171827384
4,4-difluoropiperidine;ethene;4-methylmorpholine (PubChem CID 171827384) has the molecular formula C12H24F2N2O and a molecular weight of 250.33 g/mol. Its IUPAC name is 4,4-difluoropiperidine;ethene;4-methylmorpholine.
| Compound Name | 4,4-difluoropiperidine;ethene;4-methylmorpholine |
|---|---|
| PubChem CID | 171827384 |
| Molecular Formula | C12H24F2N2O |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 4,4-difluoropiperidine;ethene;4-methylmorpholine |
| SMILES | C=C.CN1CCOCC1.FC1(F)CCNCC1 |
| InChI | InChI=1S/C5H9F2N.C5H11NO.C2H4/c6-5(7)1-3-8-4-2-5;1-6-2-4-7-5-3-6;1-2/h8H,1-4H2;2-5H2,1H3;1-2H2 |
| InChIKey | GGYOBNZIVOZLBW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|