C16H15BrN6O2 — CID 171827690
5-amino-1-(3-amino-2-methanimidoyl-6-methylphenyl)-3-(5-bromofuran-2-yl)pyrazole-4-carboxamide (PubChem CID 171827690) has the molecular formula C16H15BrN6O2 and a molecular weight of 403.24 g/mol. Its IUPAC name is 5-amino-1-(3-amino-2-methanimidoyl-6-methylphenyl)-3-(5-bromofuran-2-yl)pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-(3-amino-2-methanimidoyl-6-methylphenyl)-3-(5-bromofuran-2-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 171827690 |
| Molecular Formula | C16H15BrN6O2 |
| Molecular Weight | 403.24 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | 5-amino-1-(3-amino-2-methanimidoyl-6-methylphenyl)-3-(5-bromofuran-2-yl)pyrazole-4-carboxamide |
| SMILES | [H]/N=C/c1c(N)ccc(C)c1-n1nc(-c2ccc(Br)o2)c(C(N)=O)c1N |
| InChI | InChI=1S/C16H15BrN6O2/c1-7-2-3-9(19)8(6-18)14(7)23-15(20)12(16(21)24)13(22-23)10-4-5-11(17)25-10/h2-6,18H,19-20H2,1H3,(H2,21,24)/b18-6+ |
| InChIKey | IUBJYIJXCFDDLL-NGYBGAFCSA-N |
| XLogP | 2.46 |
| TPSA | 149.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|