C24H20F3N5O2 — CID 171828115
2-[(Z,3E)-1-amino-3-(trifluoromethylimino)prop-1-en-2-yl]-6-methyl-4-(1-methyl-2-oxo-5-phenyl-4-pyridinyl)-1H-pyrrolo[2,3-c]pyridin-7-one (PubChem CID 171828115) has the molecular formula C24H20F3N5O2 and a molecular weight of 467.45 g/mol. Its IUPAC name is 2-[(Z,3E)-1-amino-3-(trifluoromethylimino)prop-1-en-2-yl]-6-methyl-4-(1-methyl-2-oxo-5-phenyl-4-pyridinyl)-1H-pyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 2-[(Z,3E)-1-amino-3-(trifluoromethylimino)prop-1-en-2-yl]-6-methyl-4-(1-methyl-2-oxo-5-phenyl-4-pyridinyl)-1H-pyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 171828115 |
| Molecular Formula | C24H20F3N5O2 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 2-[(Z,3E)-1-amino-3-(trifluoromethylimino)prop-1-en-2-yl]-6-methyl-4-(1-methyl-2-oxo-5-phenyl-4-pyridinyl)-1H-pyrrolo[2,3-c]pyridin-7-one |
| SMILES | Cn1cc(-c2ccccc2)c(-c2cn(C)c(=O)c3[nH]c(C(=C/N)/C=N/C(F)(F)F)cc23)cc1=O |
| InChI | InChI=1S/C24H20F3N5O2/c1-31-12-18(14-6-4-3-5-7-14)16(9-21(31)33)19-13-32(2)23(34)22-17(19)8-20(30-22)15(10-28)11-29-24(25,26)27/h3-13,30H,28H2,1-2H3/b15-10+,29-11+ |
| InChIKey | VGDFYASEZAYZPN-MNUOPMLBSA-N |
| XLogP | 3.79 |
| TPSA | 98.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|