C25H22F3N5O2 — CID 174269326
2-[1-amino-3-(trifluoromethylimino)prop-1-en-2-yl]-6-ethyl-4-(1-methyl-2-oxo-5-phenyl-4-pyridinyl)-1H-pyrrolo[2,3-c]pyridin-7-one (PubChem CID 174269326) has the molecular formula C25H22F3N5O2 and a molecular weight of 481.48 g/mol. Its IUPAC name is 2-[1-amino-3-(trifluoromethylimino)prop-1-en-2-yl]-6-ethyl-4-(1-methyl-2-oxo-5-phenyl-4-pyridinyl)-1H-pyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 2-[1-amino-3-(trifluoromethylimino)prop-1-en-2-yl]-6-ethyl-4-(1-methyl-2-oxo-5-phenyl-4-pyridinyl)-1H-pyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 174269326 |
| Molecular Formula | C25H22F3N5O2 |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 2-[1-amino-3-(trifluoromethylimino)prop-1-en-2-yl]-6-ethyl-4-(1-methyl-2-oxo-5-phenyl-4-pyridinyl)-1H-pyrrolo[2,3-c]pyridin-7-one |
| SMILES | CCn1cc(-c2cc(=O)n(C)cc2-c2ccccc2)c2cc(C(C=NC(F)(F)F)=CN)[nH]c2c1=O |
| InChI | InChI=1S/C25H22F3N5O2/c1-3-33-14-20(17-10-22(34)32(2)13-19(17)15-7-5-4-6-8-15)18-9-21(31-23(18)24(33)35)16(11-29)12-30-25(26,27)28/h4-14,31H,3,29H2,1-2H3 |
| InChIKey | RKZDPIDYBOJQLF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 98.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|