C21H30F2N2 — CID 171828645
(3E)-3-(difluoromethyl)-4-methylhexa-1,3,5-triene;ethane;4-methyl-3-propan-2-yl-2H-indazole (PubChem CID 171828645) has the molecular formula C21H30F2N2 and a molecular weight of 348.48 g/mol. Its IUPAC name is (3E)-3-(difluoromethyl)-4-methylhexa-1,3,5-triene;ethane;4-methyl-3-propan-2-yl-2H-indazole.
| Compound Name | (3E)-3-(difluoromethyl)-4-methylhexa-1,3,5-triene;ethane;4-methyl-3-propan-2-yl-2H-indazole |
|---|---|
| PubChem CID | 171828645 |
| Molecular Formula | C21H30F2N2 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | (3E)-3-(difluoromethyl)-4-methylhexa-1,3,5-triene;ethane;4-methyl-3-propan-2-yl-2H-indazole |
| SMILES | C=C/C(C)=C(\C=C)C(F)F.CC.Cc1cccc2n[nH]c(C(C)C)c12 |
| InChI | InChI=1S/C11H14N2.C8H10F2.C2H6/c1-7(2)11-10-8(3)5-4-6-9(10)12-13-11;1-4-6(3)7(5-2)8(9)10;1-2/h4-7H,1-3H3,(H,12,13);4-5,8H,1-2H2,3H3;1-2H3/b;7-6+; |
| InChIKey | IKRRIFDIMLFDSK-FPCGKXSPSA-N |
| XLogP | 6.96 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|