C19H13ClFN3O7S — CID 171828826
8-chloro-1-cyclopropyl-6-fluoro-7-(3-nitro-4-sulfamoylphenyl)-4-oxoquinoline-3-carboxylic acid (PubChem CID 171828826) has the molecular formula C19H13ClFN3O7S and a molecular weight of 481.85 g/mol. Its IUPAC name is 8-chloro-1-cyclopropyl-6-fluoro-7-(3-nitro-4-sulfamoylphenyl)-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 8-chloro-1-cyclopropyl-6-fluoro-7-(3-nitro-4-sulfamoylphenyl)-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 171828826 |
| Molecular Formula | C19H13ClFN3O7S |
| Molecular Weight | 481.85 g/mol |
| Exact Mass | 481.01 |
| IUPAC Name | 8-chloro-1-cyclopropyl-6-fluoro-7-(3-nitro-4-sulfamoylphenyl)-4-oxoquinoline-3-carboxylic acid |
| SMILES | NS(=O)(=O)c1ccc(-c2c(F)cc3c(=O)c(C(=O)O)cn(C4CC4)c3c2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H13ClFN3O7S/c20-16-15(8-1-4-14(32(22,30)31)13(5-8)24(28)29)12(21)6-10-17(16)23(9-2-3-9)7-11(18(10)25)19(26)27/h1,4-7,9H,2-3H2,(H,26,27)(H2,22,30,31) |
| InChIKey | SMBBJUGCMICQAW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 162.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.85 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|