C10H18N2 — CID 171831395
3-ethyl-9-azatricyclo[3.3.1.03,9]nonan-6-amine (PubChem CID 171831395) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 3-ethyl-9-azatricyclo[3.3.1.03,9]nonan-6-amine.
| Compound Name | 3-ethyl-9-azatricyclo[3.3.1.03,9]nonan-6-amine |
|---|---|
| PubChem CID | 171831395 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 3-ethyl-9-azatricyclo[3.3.1.03,9]nonan-6-amine |
| SMILES | CCC12CC3CCC(N)C(C1)N32 |
| InChI | InChI=1S/C10H18N2/c1-2-10-5-7-3-4-8(11)9(6-10)12(7)10/h7-9H,2-6,11H2,1H3 |
| InChIKey | CRXOXKGAPBFTQU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |