C18H18F2O3 — CID 171833028
benzyl 2-(2,3-difluoro-6-methoxyphenyl)-2-methylpropanoate (PubChem CID 171833028) has the molecular formula C18H18F2O3 and a molecular weight of 320.33 g/mol. Its IUPAC name is benzyl 2-(2,3-difluoro-6-methoxyphenyl)-2-methylpropanoate.
| Compound Name | benzyl 2-(2,3-difluoro-6-methoxyphenyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 171833028 |
| Molecular Formula | C18H18F2O3 |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | benzyl 2-(2,3-difluoro-6-methoxyphenyl)-2-methylpropanoate |
| SMILES | COc1ccc(F)c(F)c1C(C)(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H18F2O3/c1-18(2,15-14(22-3)10-9-13(19)16(15)20)17(21)23-11-12-7-5-4-6-8-12/h4-10H,11H2,1-3H3 |
| InChIKey | SPXJYXKGKBGDFA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |