C17H28O2 — CID 171834500
ethane;2-[(4-ethylphenyl)methyl]-3,3-dimethylbutanoic acid (PubChem CID 171834500) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is ethane;2-[(4-ethylphenyl)methyl]-3,3-dimethylbutanoic acid.
| Compound Name | ethane;2-[(4-ethylphenyl)methyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 171834500 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | ethane;2-[(4-ethylphenyl)methyl]-3,3-dimethylbutanoic acid |
| SMILES | CC.CCc1ccc(CC(C(=O)O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H22O2.C2H6/c1-5-11-6-8-12(9-7-11)10-13(14(16)17)15(2,3)4;1-2/h6-9,13H,5,10H2,1-4H3,(H,16,17);1-2H3 |
| InChIKey | PPWGZGPVOKYFCP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |