ethane;2-[(4-ethylphenyl)methyl]-3,3-dimethylbutanoic acid

C17H28O2 — CID 171834500

IUPACethane;2-[(4-ethylphenyl)methyl]-3,3-dimethylbutanoic acid
SMILESCC.CCc1ccc(CC(C(=O)O)C(C)(C)C)cc1
InChIInChI=1S/C15H22O2.C2H6/c1-5-11-6-8-12(9-7-11)10-13(14(16)17)15(2,3)4;1-2/h6-9,13H,5,10H2,1-4H3,(H,16,17);1-2H3
InChIKeyPPWGZGPVOKYFCP-UHFFFAOYSA-N
MW264.41 g/mol
LogP4.56
Rot. Bonds4

About ethane;2-[(4-ethylphenyl)methyl]-3,3-dimethylbutanoic acid

ethane;2-[(4-ethylphenyl)methyl]-3,3-dimethylbutanoic acid (PubChem CID 171834500) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is ethane;2-[(4-ethylphenyl)methyl]-3,3-dimethylbutanoic acid.

Molecular Properties

Compound Nameethane;2-[(4-ethylphenyl)methyl]-3,3-dimethylbutanoic acid
PubChem CID171834500
Molecular FormulaC17H28O2
Molecular Weight264.41 g/mol
Exact Mass264.21
IUPAC Nameethane;2-[(4-ethylphenyl)methyl]-3,3-dimethylbutanoic acid
SMILESCC.CCc1ccc(CC(C(=O)O)C(C)(C)C)cc1
InChIInChI=1S/C15H22O2.C2H6/c1-5-11-6-8-12(9-7-11)10-13(14(16)17)15(2,3)4;1-2/h6-9,13H,5,10H2,1-4H3,(H,16,17);1-2H3
InChIKeyPPWGZGPVOKYFCP-UHFFFAOYSA-N
XLogP4.56
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.41
LogP ≤ 54.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze ethane;2-[(4-ethylphenyl)methyl]-3,3-dimethylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;2-[(4-ethylphenyl)methyl]-3,3-dimethylbutanoic acid?
The IUPAC name of ethane;2-[(4-ethylphenyl)methyl]-3,3-dimethylbutanoic acid (CID 171834500) is ethane;2-[(4-ethylphenyl)methyl]-3,3-dimethylbutanoic acid.
What is the SMILES notation for ethane;2-[(4-ethylphenyl)methyl]-3,3-dimethylbutanoic acid?
The canonical SMILES for ethane;2-[(4-ethylphenyl)methyl]-3,3-dimethylbutanoic acid is CC.CCc1ccc(CC(C(=O)O)C(C)(C)C)cc1.
What is the InChIKey of ethane;2-[(4-ethylphenyl)methyl]-3,3-dimethylbutanoic acid?
The InChIKey is PPWGZGPVOKYFCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O2.C2H6/c1-5-11-6-8-12(9-7-11)10-13(14(16)17)15(2,3)4;1-2/h6-9,13H,5,10H2,1-4H3,(H,16,17);1-2H3.
What are the key properties of ethane;2-[(4-ethylphenyl)methyl]-3,3-dimethylbutanoic acid?
ethane;2-[(4-ethylphenyl)methyl]-3,3-dimethylbutanoic acid has a molecular weight of 264.41 g/mol, XLogP of 4.56, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-[(4-ethylphenyl)methyl]-3,3-dimethylbutanoic acid is sourced from PubChem (CID 171834500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).