C13H18FNO2 — CID 68746660
2-[(3-amino-5-fluorophenyl)methyl]-3,3-dimethylbutanoic acid (PubChem CID 68746660) has the molecular formula C13H18FNO2 and a molecular weight of 239.29 g/mol. Its IUPAC name is 2-[(3-amino-5-fluorophenyl)methyl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(3-amino-5-fluorophenyl)methyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 68746660 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 2-[(3-amino-5-fluorophenyl)methyl]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(Cc1cc(N)cc(F)c1)C(=O)O |
| InChI | InChI=1S/C13H18FNO2/c1-13(2,3)11(12(16)17)6-8-4-9(14)7-10(15)5-8/h4-5,7,11H,6,15H2,1-3H3,(H,16,17) |
| InChIKey | PWEBBYAIFVRDHI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|