About 3-amino-2-[(3,5-difluorophenyl)methyl]-2-methyl-3-oxopropanoic acid
3-amino-2-[(3,5-difluorophenyl)methyl]-2-methyl-3-oxopropanoic acid (PubChem CID 105411814) has the molecular formula C11H11F2NO3
and a molecular weight of 243.21 g/mol. Its IUPAC name is 3-amino-2-[(3,5-difluorophenyl)methyl]-2-methyl-3-oxopropanoic acid.
Molecular Properties
| Compound Name | 3-amino-2-[(3,5-difluorophenyl)methyl]-2-methyl-3-oxopropanoic acid |
| PubChem CID | 105411814 |
| Molecular Formula | C11H11F2NO3 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 3-amino-2-[(3,5-difluorophenyl)methyl]-2-methyl-3-oxopropanoic acid |
| SMILES | CC(Cc1cc(F)cc(F)c1)(C(N)=O)C(=O)O |
| InChI | InChI=1S/C11H11F2NO3/c1-11(9(14)15,10(16)17)5-6-2-7(12)4-8(13)3-6/h2-4H,5H2,1H3,(H2,14,15)(H,16,17) |
| InChIKey | QBYQWGMBMZNQFM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-[(3,5-difluorophenyl)methyl]-2-methyl-3-oxopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-[(3,5-difluorophenyl)methyl]-2-methyl-3-oxopropanoic acid?
The IUPAC name of 3-amino-2-[(3,5-difluorophenyl)methyl]-2-methyl-3-oxopropanoic acid (CID 105411814) is 3-amino-2-[(3,5-difluorophenyl)methyl]-2-methyl-3-oxopropanoic acid.
What is the SMILES notation for 3-amino-2-[(3,5-difluorophenyl)methyl]-2-methyl-3-oxopropanoic acid?
The canonical SMILES for 3-amino-2-[(3,5-difluorophenyl)methyl]-2-methyl-3-oxopropanoic acid is CC(Cc1cc(F)cc(F)c1)(C(N)=O)C(=O)O.
What is the InChIKey of 3-amino-2-[(3,5-difluorophenyl)methyl]-2-methyl-3-oxopropanoic acid?
The InChIKey is QBYQWGMBMZNQFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2NO3/c1-11(9(14)15,10(16)17)5-6-2-7(12)4-8(13)3-6/h2-4H,5H2,1H3,(H2,14,15)(H,16,17).
What are the key properties of 3-amino-2-[(3,5-difluorophenyl)methyl]-2-methyl-3-oxopropanoic acid?
3-amino-2-[(3,5-difluorophenyl)methyl]-2-methyl-3-oxopropanoic acid has a molecular weight of 243.21 g/mol, XLogP of 1.08, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-[(3,5-difluorophenyl)methyl]-2-methyl-3-oxopropanoic acid is sourced from PubChem (CID 105411814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).