C14H19NO3 — CID 114899950
3-amino-2-methyl-3-oxo-2-[(2,4,6-trimethylphenyl)methyl]propanoic acid (PubChem CID 114899950) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 3-amino-2-methyl-3-oxo-2-[(2,4,6-trimethylphenyl)methyl]propanoic acid.
| Compound Name | 3-amino-2-methyl-3-oxo-2-[(2,4,6-trimethylphenyl)methyl]propanoic acid |
|---|---|
| PubChem CID | 114899950 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 3-amino-2-methyl-3-oxo-2-[(2,4,6-trimethylphenyl)methyl]propanoic acid |
| SMILES | Cc1cc(C)c(CC(C)(C(N)=O)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C14H19NO3/c1-8-5-9(2)11(10(3)6-8)7-14(4,12(15)16)13(17)18/h5-6H,7H2,1-4H3,(H2,15,16)(H,17,18) |
| InChIKey | FKANQWLTUFRRSA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|