C12H14FNO3 — CID 114899883
3-amino-2-[(4-fluoro-2-methylphenyl)methyl]-2-methyl-3-oxopropanoic acid (PubChem CID 114899883) has the molecular formula C12H14FNO3 and a molecular weight of 239.25 g/mol. Its IUPAC name is 3-amino-2-[(4-fluoro-2-methylphenyl)methyl]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-amino-2-[(4-fluoro-2-methylphenyl)methyl]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 114899883 |
| Molecular Formula | C12H14FNO3 |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 3-amino-2-[(4-fluoro-2-methylphenyl)methyl]-2-methyl-3-oxopropanoic acid |
| SMILES | Cc1cc(F)ccc1CC(C)(C(N)=O)C(=O)O |
| InChI | InChI=1S/C12H14FNO3/c1-7-5-9(13)4-3-8(7)6-12(2,10(14)15)11(16)17/h3-5H,6H2,1-2H3,(H2,14,15)(H,16,17) |
| InChIKey | CJVJQXOQKVRQRA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|