C14H17F2NO4 — CID 69297752
2-amino-2-[(3,5-difluorophenyl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid (PubChem CID 69297752) has the molecular formula C14H17F2NO4 and a molecular weight of 301.29 g/mol. Its IUPAC name is 2-amino-2-[(3,5-difluorophenyl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid.
| Compound Name | 2-amino-2-[(3,5-difluorophenyl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 69297752 |
| Molecular Formula | C14H17F2NO4 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-amino-2-[(3,5-difluorophenyl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid |
| SMILES | CC(C)(C)OC(=O)C(N)(Cc1cc(F)cc(F)c1)C(=O)O |
| InChI | InChI=1S/C14H17F2NO4/c1-13(2,3)21-12(20)14(17,11(18)19)7-8-4-9(15)6-10(16)5-8/h4-6H,7,17H2,1-3H3,(H,18,19) |
| InChIKey | UMGQVLWDZMMRCI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|