C25H26O2 — CID 23221685
2-[(3,5-dimethylphenyl)methyl]-3,3-diphenylbutanoic acid (PubChem CID 23221685) has the molecular formula C25H26O2 and a molecular weight of 358.48 g/mol. Its IUPAC name is 2-[(3,5-dimethylphenyl)methyl]-3,3-diphenylbutanoic acid.
| Compound Name | 2-[(3,5-dimethylphenyl)methyl]-3,3-diphenylbutanoic acid |
|---|---|
| PubChem CID | 23221685 |
| Molecular Formula | C25H26O2 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 2-[(3,5-dimethylphenyl)methyl]-3,3-diphenylbutanoic acid |
| SMILES | Cc1cc(C)cc(CC(C(=O)O)C(C)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C25H26O2/c1-18-14-19(2)16-20(15-18)17-23(24(26)27)25(3,21-10-6-4-7-11-21)22-12-8-5-9-13-22/h4-16,23H,17H2,1-3H3,(H,26,27) |
| InChIKey | QKLNHELOQRXKQX-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |