C14H20N2O — CID 171834808
4-(4-ethylphenyl)-1-methyl-1,4-diazepan-5-one (PubChem CID 171834808) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 4-(4-ethylphenyl)-1-methyl-1,4-diazepan-5-one.
| Compound Name | 4-(4-ethylphenyl)-1-methyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 171834808 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 4-(4-ethylphenyl)-1-methyl-1,4-diazepan-5-one |
| SMILES | CCc1ccc(N2CCN(C)CCC2=O)cc1 |
| InChI | InChI=1S/C14H20N2O/c1-3-12-4-6-13(7-5-12)16-11-10-15(2)9-8-14(16)17/h4-7H,3,8-11H2,1-2H3 |
| InChIKey | BNPQABTWVDQGPO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |