About ethane;[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]methyl hypofluorite
ethane;[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]methyl hypofluorite (PubChem CID 153379478) has the molecular formula C14H21FN2O2
and a molecular weight of 268.33 g/mol. Its IUPAC name is ethane;[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]methyl hypofluorite.
Molecular Properties
| Compound Name | ethane;[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]methyl hypofluorite |
| PubChem CID | 153379478 |
| Molecular Formula | C14H21FN2O2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | ethane;[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]methyl hypofluorite |
| SMILES | CC.CN1CCN(c2ccc(COF)cc2)C(=O)C1 |
| InChI | InChI=1S/C12H15FN2O2.C2H6/c1-14-6-7-15(12(16)8-14)11-4-2-10(3-5-11)9-17-13;1-2/h2-5H,6-9H2,1H3;1-2H3 |
| InChIKey | HIVVHMWEEKHUIZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]methyl hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]methyl hypofluorite?
The IUPAC name of ethane;[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]methyl hypofluorite (CID 153379478) is ethane;[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]methyl hypofluorite.
What is the SMILES notation for ethane;[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]methyl hypofluorite?
The canonical SMILES for ethane;[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]methyl hypofluorite is CC.CN1CCN(c2ccc(COF)cc2)C(=O)C1.
What is the InChIKey of ethane;[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]methyl hypofluorite?
The InChIKey is HIVVHMWEEKHUIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FN2O2.C2H6/c1-14-6-7-15(12(16)8-14)11-4-2-10(3-5-11)9-17-13;1-2/h2-5H,6-9H2,1H3;1-2H3.
What are the key properties of ethane;[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]methyl hypofluorite?
ethane;[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]methyl hypofluorite has a molecular weight of 268.33 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]methyl hypofluorite is sourced from PubChem (CID 153379478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).