C17H28ClN5O — CID 171837837
1-[2-[(3R)-3-[(6-chloro-5-methylpyridazin-3-yl)amino]piperidin-1-yl]ethyl]piperidin-4-ol (PubChem CID 171837837) has the molecular formula C17H28ClN5O and a molecular weight of 353.90 g/mol. Its IUPAC name is 1-[2-[(3R)-3-[(6-chloro-5-methylpyridazin-3-yl)amino]piperidin-1-yl]ethyl]piperidin-4-ol.
| Compound Name | 1-[2-[(3R)-3-[(6-chloro-5-methylpyridazin-3-yl)amino]piperidin-1-yl]ethyl]piperidin-4-ol |
|---|---|
| PubChem CID | 171837837 |
| Molecular Formula | C17H28ClN5O |
| Molecular Weight | 353.90 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 1-[2-[(3R)-3-[(6-chloro-5-methylpyridazin-3-yl)amino]piperidin-1-yl]ethyl]piperidin-4-ol |
| SMILES | Cc1cc(N[C@@H]2CCCN(CCN3CCC(O)CC3)C2)nnc1Cl |
| InChI | InChI=1S/C17H28ClN5O/c1-13-11-16(20-21-17(13)18)19-14-3-2-6-23(12-14)10-9-22-7-4-15(24)5-8-22/h11,14-15,24H,2-10,12H2,1H3,(H,19,20)/t14-/m1/s1 |
| InChIKey | FBJUHNUWUUCDPB-CQSZACIVSA-N |
| XLogP | 1.77 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.90 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |