C17H29N3O2 — CID 171843537
[4-(propan-2-ylamino)phenyl]methyl N-[2-(dimethylamino)ethyl]-N-ethylcarbamate (PubChem CID 171843537) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is [4-(propan-2-ylamino)phenyl]methyl N-[2-(dimethylamino)ethyl]-N-ethylcarbamate.
| Compound Name | [4-(propan-2-ylamino)phenyl]methyl N-[2-(dimethylamino)ethyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 171843537 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | [4-(propan-2-ylamino)phenyl]methyl N-[2-(dimethylamino)ethyl]-N-ethylcarbamate |
| SMILES | CCN(CCN(C)C)C(=O)OCc1ccc(NC(C)C)cc1 |
| InChI | InChI=1S/C17H29N3O2/c1-6-20(12-11-19(4)5)17(21)22-13-15-7-9-16(10-8-15)18-14(2)3/h7-10,14,18H,6,11-13H2,1-5H3 |
| InChIKey | DWJRNLNVPCVEFN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |