C22H23N7 — CID 171844211
N-[(2-pyrazol-1-ylphenyl)methyl]spiro[1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,1'-cyclopentane]-2-amine (PubChem CID 171844211) has the molecular formula C22H23N7 and a molecular weight of 385.48 g/mol. Its IUPAC name is N-[(2-pyrazol-1-ylphenyl)methyl]spiro[1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,1'-cyclopentane]-2-amine.
| Compound Name | N-[(2-pyrazol-1-ylphenyl)methyl]spiro[1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,1'-cyclopentane]-2-amine |
|---|---|
| PubChem CID | 171844211 |
| Molecular Formula | C22H23N7 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N-[(2-pyrazol-1-ylphenyl)methyl]spiro[1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,1'-cyclopentane]-2-amine |
| SMILES | c1ccc(-n2cccn2)c(CNc2c3c(nc4ccnn24)C2(CCCC2)NC3)c1 |
| InChI | InChI=1S/C22H23N7/c1-2-7-18(28-13-5-11-25-28)16(6-1)14-23-21-17-15-24-22(9-3-4-10-22)20(17)27-19-8-12-26-29(19)21/h1-2,5-8,11-13,23-24H,3-4,9-10,14-15H2 |
| InChIKey | YURKCQSJUABAGP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 72.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |