C11H19IN2 — CID 171845182
2-(cyclopropylmethyl)-8-iodo-2,8-diazaspiro[3.5]nonane (PubChem CID 171845182) has the molecular formula C11H19IN2 and a molecular weight of 306.19 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-8-iodo-2,8-diazaspiro[3.5]nonane.
| Compound Name | 2-(cyclopropylmethyl)-8-iodo-2,8-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 171845182 |
| Molecular Formula | C11H19IN2 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-(cyclopropylmethyl)-8-iodo-2,8-diazaspiro[3.5]nonane |
| SMILES | IN1CCCC2(C1)CN(CC1CC1)C2 |
| InChI | InChI=1S/C11H19IN2/c12-14-5-1-4-11(9-14)7-13(8-11)6-10-2-3-10/h10H,1-9H2 |
| InChIKey | LGWDYAGUDCPXCY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|