About 1-(2-iodo-2,9-diazaspiro[5.5]undecan-9-yl)-2-methylpropan-2-ol
1-(2-iodo-2,9-diazaspiro[5.5]undecan-9-yl)-2-methylpropan-2-ol (PubChem CID 175628880) has the molecular formula C13H25IN2O
and a molecular weight of 352.26 g/mol. Its IUPAC name is 1-(2-iodo-2,9-diazaspiro[5.5]undecan-9-yl)-2-methylpropan-2-ol.
Molecular Properties
| Compound Name | 1-(2-iodo-2,9-diazaspiro[5.5]undecan-9-yl)-2-methylpropan-2-ol |
| PubChem CID | 175628880 |
| Molecular Formula | C13H25IN2O |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 1-(2-iodo-2,9-diazaspiro[5.5]undecan-9-yl)-2-methylpropan-2-ol |
| SMILES | CC(C)(O)CN1CCC2(CCCN(I)C2)CC1 |
| InChI | InChI=1S/C13H25IN2O/c1-12(2,17)10-15-8-5-13(6-9-15)4-3-7-16(14)11-13/h17H,3-11H2,1-2H3 |
| InChIKey | WRFZNTLROBTWGQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-iodo-2,9-diazaspiro[5.5]undecan-9-yl)-2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-iodo-2,9-diazaspiro[5.5]undecan-9-yl)-2-methylpropan-2-ol?
The IUPAC name of 1-(2-iodo-2,9-diazaspiro[5.5]undecan-9-yl)-2-methylpropan-2-ol (CID 175628880) is 1-(2-iodo-2,9-diazaspiro[5.5]undecan-9-yl)-2-methylpropan-2-ol.
What is the SMILES notation for 1-(2-iodo-2,9-diazaspiro[5.5]undecan-9-yl)-2-methylpropan-2-ol?
The canonical SMILES for 1-(2-iodo-2,9-diazaspiro[5.5]undecan-9-yl)-2-methylpropan-2-ol is CC(C)(O)CN1CCC2(CCCN(I)C2)CC1.
What is the InChIKey of 1-(2-iodo-2,9-diazaspiro[5.5]undecan-9-yl)-2-methylpropan-2-ol?
The InChIKey is WRFZNTLROBTWGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25IN2O/c1-12(2,17)10-15-8-5-13(6-9-15)4-3-7-16(14)11-13/h17H,3-11H2,1-2H3.
What are the key properties of 1-(2-iodo-2,9-diazaspiro[5.5]undecan-9-yl)-2-methylpropan-2-ol?
1-(2-iodo-2,9-diazaspiro[5.5]undecan-9-yl)-2-methylpropan-2-ol has a molecular weight of 352.26 g/mol, XLogP of 2.29, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-iodo-2,9-diazaspiro[5.5]undecan-9-yl)-2-methylpropan-2-ol is sourced from PubChem (CID 175628880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).