About ethyl-[ethyl(propan-2-yl)carbamoyl]azanide;neodymium
ethyl-[ethyl(propan-2-yl)carbamoyl]azanide;neodymium (PubChem CID 171845858) has the molecular formula C8H17N2NdO-
and a molecular weight of 301.48 g/mol. Its IUPAC name is ethyl-[ethyl(propan-2-yl)carbamoyl]azanide;neodymium.
Molecular Properties
| Compound Name | ethyl-[ethyl(propan-2-yl)carbamoyl]azanide;neodymium |
| PubChem CID | 171845858 |
| Molecular Formula | C8H17N2NdO- |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | ethyl-[ethyl(propan-2-yl)carbamoyl]azanide;neodymium |
| SMILES | CC[N-]C(=O)N(CC)C(C)C.[Nd] |
| InChI | InChI=1S/C8H18N2O.Nd/c1-5-9-8(11)10(6-2)7(3)4;/h7H,5-6H2,1-4H3,(H,9,11);/p-1 |
| InChIKey | HPWNZLJNZDADLY-UHFFFAOYSA-M |
| XLogP | 2.23 |
| TPSA | 34.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethyl-[ethyl(propan-2-yl)carbamoyl]azanide;neodymium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-[ethyl(propan-2-yl)carbamoyl]azanide;neodymium?
The IUPAC name of ethyl-[ethyl(propan-2-yl)carbamoyl]azanide;neodymium (CID 171845858) is ethyl-[ethyl(propan-2-yl)carbamoyl]azanide;neodymium.
What is the SMILES notation for ethyl-[ethyl(propan-2-yl)carbamoyl]azanide;neodymium?
The canonical SMILES for ethyl-[ethyl(propan-2-yl)carbamoyl]azanide;neodymium is CC[N-]C(=O)N(CC)C(C)C.[Nd].
What is the InChIKey of ethyl-[ethyl(propan-2-yl)carbamoyl]azanide;neodymium?
The InChIKey is HPWNZLJNZDADLY-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H18N2O.Nd/c1-5-9-8(11)10(6-2)7(3)4;/h7H,5-6H2,1-4H3,(H,9,11);/p-1.
What are the key properties of ethyl-[ethyl(propan-2-yl)carbamoyl]azanide;neodymium?
ethyl-[ethyl(propan-2-yl)carbamoyl]azanide;neodymium has a molecular weight of 301.48 g/mol, XLogP of 2.23, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-[ethyl(propan-2-yl)carbamoyl]azanide;neodymium is sourced from PubChem (CID 171845858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).