C12H14BrN3O3 — CID 171846451
1-(4-bromo-2-nitrophenyl)-6,6-dimethyl-1,3-diazinan-2-one (PubChem CID 171846451) has the molecular formula C12H14BrN3O3 and a molecular weight of 328.17 g/mol. Its IUPAC name is 1-(4-bromo-2-nitrophenyl)-6,6-dimethyl-1,3-diazinan-2-one.
| Compound Name | 1-(4-bromo-2-nitrophenyl)-6,6-dimethyl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 171846451 |
| Molecular Formula | C12H14BrN3O3 |
| Molecular Weight | 328.17 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 1-(4-bromo-2-nitrophenyl)-6,6-dimethyl-1,3-diazinan-2-one |
| SMILES | CC1(C)CCNC(=O)N1c1ccc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14BrN3O3/c1-12(2)5-6-14-11(17)15(12)9-4-3-8(13)7-10(9)16(18)19/h3-4,7H,5-6H2,1-2H3,(H,14,17) |
| InChIKey | HRQKIRNVRGWZOW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.17 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|