About (NZ)-N'-methyl-N-prop-2-enylidenepiperidine-1-carboximidamide
(NZ)-N'-methyl-N-prop-2-enylidenepiperidine-1-carboximidamide (PubChem CID 171847589) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is (NZ)-N'-methyl-N-prop-2-enylidenepiperidine-1-carboximidamide.
Molecular Properties
| Compound Name | (NZ)-N'-methyl-N-prop-2-enylidenepiperidine-1-carboximidamide |
| PubChem CID | 171847589 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | (NZ)-N'-methyl-N-prop-2-enylidenepiperidine-1-carboximidamide |
| SMILES | C=C/C=N\C(=N/C)N1CCCCC1 |
| InChI | InChI=1S/C10H17N3/c1-3-7-12-10(11-2)13-8-5-4-6-9-13/h3,7H,1,4-6,8-9H2,2H3/b11-10+,12-7- |
| InChIKey | GYUZQNSUVWIHCG-RFWXHOBXSA-N |
| XLogP | 1.71 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N'-methyl-N-prop-2-enylidenepiperidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N'-methyl-N-prop-2-enylidenepiperidine-1-carboximidamide?
The IUPAC name of (NZ)-N'-methyl-N-prop-2-enylidenepiperidine-1-carboximidamide (CID 171847589) is (NZ)-N'-methyl-N-prop-2-enylidenepiperidine-1-carboximidamide.
What is the SMILES notation for (NZ)-N'-methyl-N-prop-2-enylidenepiperidine-1-carboximidamide?
The canonical SMILES for (NZ)-N'-methyl-N-prop-2-enylidenepiperidine-1-carboximidamide is C=C/C=N\C(=N/C)N1CCCCC1.
What is the InChIKey of (NZ)-N'-methyl-N-prop-2-enylidenepiperidine-1-carboximidamide?
The InChIKey is GYUZQNSUVWIHCG-RFWXHOBXSA-N. The full InChI is InChI=1S/C10H17N3/c1-3-7-12-10(11-2)13-8-5-4-6-9-13/h3,7H,1,4-6,8-9H2,2H3/b11-10+,12-7-.
What are the key properties of (NZ)-N'-methyl-N-prop-2-enylidenepiperidine-1-carboximidamide?
(NZ)-N'-methyl-N-prop-2-enylidenepiperidine-1-carboximidamide has a molecular weight of 179.27 g/mol, XLogP of 1.71, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N'-methyl-N-prop-2-enylidenepiperidine-1-carboximidamide is sourced from PubChem (CID 171847589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).