C12H24N4 — CID 169104162
(NZ)-N',4-dimethyl-N-prop-2-enylidenepiperazine-1-carboximidamide;ethane (PubChem CID 169104162) has the molecular formula C12H24N4 and a molecular weight of 224.35 g/mol. Its IUPAC name is (NZ)-N',4-dimethyl-N-prop-2-enylidenepiperazine-1-carboximidamide;ethane.
| Compound Name | (NZ)-N',4-dimethyl-N-prop-2-enylidenepiperazine-1-carboximidamide;ethane |
|---|---|
| PubChem CID | 169104162 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | (NZ)-N',4-dimethyl-N-prop-2-enylidenepiperazine-1-carboximidamide;ethane |
| SMILES | C=C/C=N\C(=N/C)N1CCN(C)CC1.CC |
| InChI | InChI=1S/C10H18N4.C2H6/c1-4-5-12-10(11-2)14-8-6-13(3)7-9-14;1-2/h4-5H,1,6-9H2,2-3H3;1-2H3/b11-10+,12-5-; |
| InChIKey | JCQDMGWWACJRTQ-FBOUHGLMSA-N |
| XLogP | 1.50 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|